About diphenoxytin(2+)
diphenoxytin(2+) (PubChem CID 66896971) has the molecular formula C12H10O2Sn+2
and a molecular weight of 304.92 g/mol. Its IUPAC name is diphenoxytin(2+).
Molecular Properties
| Compound Name | diphenoxytin(2+) |
| PubChem CID | 66896971 |
| Molecular Formula | C12H10O2Sn+2 |
| Molecular Weight | 304.92 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | diphenoxytin(2+) |
| SMILES | c1ccc(O[Sn+2]Oc2ccccc2)cc1 |
| InChI | InChI=1S/2C6H6O.Sn/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+4/p-2 |
| InChIKey | VAKFRQLZFABNDA-UHFFFAOYSA-L |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenoxytin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxytin(2+)?
The IUPAC name of diphenoxytin(2+) (CID 66896971) is diphenoxytin(2+).
What is the SMILES notation for diphenoxytin(2+)?
The canonical SMILES for diphenoxytin(2+) is c1ccc(O[Sn+2]Oc2ccccc2)cc1.
What is the InChIKey of diphenoxytin(2+)?
The InChIKey is VAKFRQLZFABNDA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6O.Sn/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+4/p-2.
What are the key properties of diphenoxytin(2+)?
diphenoxytin(2+) has a molecular weight of 304.92 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxytin(2+) is sourced from PubChem (CID 66896971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).