C16H31NO3 — CID 163632638
N-acetyl-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propanamide (PubChem CID 163632638) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-acetyl-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propanamide.
| Compound Name | N-acetyl-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propanamide |
|---|---|
| PubChem CID | 163632638 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | N-acetyl-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propanamide |
| SMILES | CC(=O)NC(=O)CCOC(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-12(18)17-13(19)9-10-20-16(8,15(5,6)7)11-14(2,3)4/h9-11H2,1-8H3,(H,17,18,19) |
| InChIKey | HXLLDUCGFXXIEJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |