C9H9NS — CID 163642980
N-(2-methyl-3-bicyclo[4.1.0]hept-2-en-4-ynyl)methanethioamide (PubChem CID 163642980) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is N-(2-methyl-3-bicyclo[4.1.0]hept-2-en-4-ynyl)methanethioamide.
| Compound Name | N-(2-methyl-3-bicyclo[4.1.0]hept-2-en-4-ynyl)methanethioamide |
|---|---|
| PubChem CID | 163642980 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | N-(2-methyl-3-bicyclo[4.1.0]hept-2-en-4-ynyl)methanethioamide |
| SMILES | CC1=C(NC=S)C#CC2CC12 |
| InChI | InChI=1S/C9H9NS/c1-6-8-4-7(8)2-3-9(6)10-5-11/h5,7-8H,4H2,1H3,(H,10,11) |
| InChIKey | IFWBWVZWDQFQEH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|