C7H10BrOTl — CID 163658873
bromo-[(2E)-2-ethoxypenta-2,4-dienylidene]thallane (PubChem CID 163658873) has the molecular formula C7H10BrOTl and a molecular weight of 394.44 g/mol. Its IUPAC name is bromo-[(2E)-2-ethoxypenta-2,4-dienylidene]thallane.
| Compound Name | bromo-[(2E)-2-ethoxypenta-2,4-dienylidene]thallane |
|---|---|
| PubChem CID | 163658873 |
| Molecular Formula | C7H10BrOTl |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | bromo-[(2E)-2-ethoxypenta-2,4-dienylidene]thallane |
| SMILES | C=C/C=C(\C=[Tl]\Br)OCC |
| InChI | InChI=1S/C7H10O.BrH.Tl/c1-4-6-7(3)8-5-2;;/h3-4,6H,1,5H2,2H3;1H;/q;;+1/p-1/b7-6+;; |
| InChIKey | ISQRUJDFAUWYLM-KMXZHCNGSA-M |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|