C42H32N4O2 — CID 163659882
2-[(2E,3Z)-3-ethylidene-1-phenyl-2-prop-2-enylideneindol-5-yl]-9-[(2S)-6-(4-nitrophenyl)-1,2-dihydropyridin-2-yl]carbazole (PubChem CID 163659882) has the molecular formula C42H32N4O2 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-[(2E,3Z)-3-ethylidene-1-phenyl-2-prop-2-enylideneindol-5-yl]-9-[(2S)-6-(4-nitrophenyl)-1,2-dihydropyridin-2-yl]carbazole.
| Compound Name | 2-[(2E,3Z)-3-ethylidene-1-phenyl-2-prop-2-enylideneindol-5-yl]-9-[(2S)-6-(4-nitrophenyl)-1,2-dihydropyridin-2-yl]carbazole |
|---|---|
| PubChem CID | 163659882 |
| Molecular Formula | C42H32N4O2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-[(2E,3Z)-3-ethylidene-1-phenyl-2-prop-2-enylideneindol-5-yl]-9-[(2S)-6-(4-nitrophenyl)-1,2-dihydropyridin-2-yl]carbazole |
| SMILES | C=C/C=c1\c(=C/C)c2cc(-c3ccc4c5ccccc5n([C@H]5C=CC=C(c6ccc([N+](=O)[O-])cc6)N5)c4c3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C42H32N4O2/c1-3-11-38-33(4-2)36-26-29(21-25-40(36)44(38)31-12-6-5-7-13-31)30-20-24-35-34-14-8-9-16-39(34)45(41(35)27-30)42-17-10-15-37(43-42)28-18-22-32(23-19-28)46(47)48/h3-27,42-43H,1H2,2H3/b33-4-,38-11+/t42-/m0/s1 |
| InChIKey | ITMHVYZIUATHDU-MRJFYKPHSA-N |
| XLogP | 8.78 |
| TPSA | 65.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|