C17H16N2O2 — CID 163662851
(3E)-3-[4,5-bis(ethenyl)-1-methyl-2-oxopyrrolidin-3-ylidene]-1H-indol-2-one (PubChem CID 163662851) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (3E)-3-[4,5-bis(ethenyl)-1-methyl-2-oxopyrrolidin-3-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[4,5-bis(ethenyl)-1-methyl-2-oxopyrrolidin-3-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 163662851 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3E)-3-[4,5-bis(ethenyl)-1-methyl-2-oxopyrrolidin-3-ylidene]-1H-indol-2-one |
| SMILES | C=CC1/C(=C2\C(=O)Nc3ccccc32)C(=O)N(C)C1C=C |
| InChI | InChI=1S/C17H16N2O2/c1-4-10-13(5-2)19(3)17(21)15(10)14-11-8-6-7-9-12(11)18-16(14)20/h4-10,13H,1-2H2,3H3,(H,18,20)/b15-14+ |
| InChIKey | IVVZFAXYBBBINS-CCEZHUSRSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|