C18H15NO — CID 163667445
5-[(2E)-penta-2,4-dien-2-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 163667445) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-[(2E)-penta-2,4-dien-2-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 5-[(2E)-penta-2,4-dien-2-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 163667445 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 5-[(2E)-penta-2,4-dien-2-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | C=C/C=C(\C)c1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C18H15NO/c1-3-7-13(2)15-10-11-17-16(12-15)19-18(20-17)14-8-5-4-6-9-14/h3-12H,1H2,2H3/b13-7+ |
| InChIKey | IZRYIXHDRUZYBC-NTUHNPAUSA-N |
| XLogP | 5.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|