C24H36N4O4S — CID 163682236
(2S)-2-acetamido-N-[(3S,6R)-9-(1-aminoethylideneamino)-6-formyl-1-methylsulfanyl-4-oxononan-3-yl]-3-phenylpropanamide (PubChem CID 163682236) has the molecular formula C24H36N4O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(3S,6R)-9-(1-aminoethylideneamino)-6-formyl-1-methylsulfanyl-4-oxononan-3-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-acetamido-N-[(3S,6R)-9-(1-aminoethylideneamino)-6-formyl-1-methylsulfanyl-4-oxononan-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 163682236 |
| Molecular Formula | C24H36N4O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (2S)-2-acetamido-N-[(3S,6R)-9-(1-aminoethylideneamino)-6-formyl-1-methylsulfanyl-4-oxononan-3-yl]-3-phenylpropanamide |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)C[C@H](C=O)CCC/N=C(\C)N |
| InChI | InChI=1S/C24H36N4O4S/c1-17(25)26-12-7-10-20(16-29)15-23(31)21(11-13-33-3)28-24(32)22(27-18(2)30)14-19-8-5-4-6-9-19/h4-6,8-9,16,20-22H,7,10-15H2,1-3H3,(H2,25,26)(H,27,30)(H,28,32)/t20-,21+,22+/m1/s1 |
| InChIKey | SSIWMXWCFDNAJL-FSSWDIPSSA-N |
| XLogP | 1.90 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|