C15H31O4PY — CID 163686868
(2S,3S,5S)-2,3-dimethyl-5-(2-methylpropoxyphosphonoyloxymethyl)-4-(2-methylpropyl)oxolane;yttrium (PubChem CID 163686868) has the molecular formula C15H31O4PY and a molecular weight of 395.29 g/mol. Its IUPAC name is (2S,3S,5S)-2,3-dimethyl-5-(2-methylpropoxyphosphonoyloxymethyl)-4-(2-methylpropyl)oxolane;yttrium.
| Compound Name | (2S,3S,5S)-2,3-dimethyl-5-(2-methylpropoxyphosphonoyloxymethyl)-4-(2-methylpropyl)oxolane;yttrium |
|---|---|
| PubChem CID | 163686868 |
| Molecular Formula | C15H31O4PY |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S,3S,5S)-2,3-dimethyl-5-(2-methylpropoxyphosphonoyloxymethyl)-4-(2-methylpropyl)oxolane;yttrium |
| SMILES | CC(C)CO[PH](=O)OC[C@H]1O[C@@H](C)[C@@H](C)C1CC(C)C.[Y] |
| InChI | InChI=1S/C15H31O4P.Y/c1-10(2)7-14-12(5)13(6)19-15(14)9-18-20(16)17-8-11(3)4;/h10-15,20H,7-9H2,1-6H3;/t12-,13+,14?,15-;/m1./s1 |
| InChIKey | JPPLVYGVUYRBFR-ISXUQMITSA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|