C14H28O5P+ — CID 158800100
[(2R,3S,4S,5S)-3-ethoxy-4,5-dimethyloxolan-2-yl]methoxy-oxo-pentan-3-yloxyphosphanium (PubChem CID 158800100) has the molecular formula C14H28O5P+ and a molecular weight of 307.35 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3-ethoxy-4,5-dimethyloxolan-2-yl]methoxy-oxo-pentan-3-yloxyphosphanium.
| Compound Name | [(2R,3S,4S,5S)-3-ethoxy-4,5-dimethyloxolan-2-yl]methoxy-oxo-pentan-3-yloxyphosphanium |
|---|---|
| PubChem CID | 158800100 |
| Molecular Formula | C14H28O5P+ |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [(2R,3S,4S,5S)-3-ethoxy-4,5-dimethyloxolan-2-yl]methoxy-oxo-pentan-3-yloxyphosphanium |
| SMILES | CCO[C@H]1[C@@H](C)[C@H](C)O[C@@H]1CO[P+](=O)OC(CC)CC |
| InChI | InChI=1S/C14H28O5P/c1-6-12(7-2)19-20(15)17-9-13-14(16-8-3)10(4)11(5)18-13/h10-14H,6-9H2,1-5H3/q+1/t10-,11-,13+,14-/m0/s1 |
| InChIKey | NYWDUFICYGSMFS-VTPLQMEGSA-N |
| XLogP | 3.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|