C19H36BO5PY — CID 163909475
CID 163909475 (PubChem CID 163909475) has the molecular formula C19H36BO5PY and a molecular weight of 475.18 g/mol.
| Compound Name | CID 163909475 |
|---|---|
| PubChem CID | 163909475 |
| Molecular Formula | C19H36BO5PY |
| Molecular Weight | 475.18 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](C(C)C)[C@H](O[PH](=O)CC[C@H]2O[C@@H](C)C(C)[C@H]2OC(C)C)C1C.[Y] |
| InChI | InChI=1S/C19H36BO5P.Y/c1-10(2)16-18(13(6)19(20)24-16)25-26(21)9-8-15-17(22-11(3)4)12(5)14(7)23-15;/h10-19,26H,8-9H2,1-7H3;/t12?,13?,14-,15+,16+,17+,18+,19+;/m0./s1 |
| InChIKey | AHWIUMNCRVPMBQ-DQZVECFMSA-N |
| XLogP | 3.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|