C14H28O6P- — CID 21028172
[4,5-dimethyl-2-(2-propan-2-yloxyethyl)oxolan-3-yl] propan-2-yl phosphate (PubChem CID 21028172) has the molecular formula C14H28O6P- and a molecular weight of 323.35 g/mol. Its IUPAC name is [4,5-dimethyl-2-(2-propan-2-yloxyethyl)oxolan-3-yl] propan-2-yl phosphate.
| Compound Name | [4,5-dimethyl-2-(2-propan-2-yloxyethyl)oxolan-3-yl] propan-2-yl phosphate |
|---|---|
| PubChem CID | 21028172 |
| Molecular Formula | C14H28O6P- |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4,5-dimethyl-2-(2-propan-2-yloxyethyl)oxolan-3-yl] propan-2-yl phosphate |
| SMILES | CC(C)OCCC1OC(C)C(C)C1OP(=O)([O-])OC(C)C |
| InChI | InChI=1S/C14H29O6P/c1-9(2)17-8-7-13-14(11(5)12(6)18-13)20-21(15,16)19-10(3)4/h9-14H,7-8H2,1-6H3,(H,15,16)/p-1 |
| InChIKey | RQCOJOQHYISJSC-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|