C15H30O9P- — CID 59148897
2-[2-(2-hydroxyethoxy)ethoxy]ethyl [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate (PubChem CID 59148897) has the molecular formula C15H30O9P- and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 59148897 |
| Molecular Formula | C15H30O9P- |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate |
| SMILES | CC(C)C[C@H]1O[C@@H](C)[C@H](O)[C@@H]1OP(=O)([O-])OCCOCCOCCO |
| InChI | InChI=1S/C15H31O9P/c1-11(2)10-13-15(14(17)12(3)23-13)24-25(18,19)22-9-8-21-7-6-20-5-4-16/h11-17H,4-10H2,1-3H3,(H,18,19)/p-1/t12-,13+,14-,15+/m0/s1 |
| InChIKey | WYXBCJSJBUJYMI-LJISPDSOSA-M |
| XLogP | 0.08 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|