C15H28O7P- — CID 59148899
(4-hydroxycyclohexyl) [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate (PubChem CID 59148899) has the molecular formula C15H28O7P- and a molecular weight of 351.36 g/mol. Its IUPAC name is (4-hydroxycyclohexyl) [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate.
| Compound Name | (4-hydroxycyclohexyl) [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 59148899 |
| Molecular Formula | C15H28O7P- |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (4-hydroxycyclohexyl) [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] phosphate |
| SMILES | CC(C)C[C@H]1O[C@@H](C)[C@H](O)[C@@H]1OP(=O)([O-])OC1CCC(O)CC1 |
| InChI | InChI=1S/C15H29O7P/c1-9(2)8-13-15(14(17)10(3)20-13)22-23(18,19)21-12-6-4-11(16)5-7-12/h9-17H,4-8H2,1-3H3,(H,18,19)/p-1/t10-,11?,12?,13+,14-,15+/m0/s1 |
| InChIKey | RGTUHNVOTXRKIK-GCDWZHDASA-M |
| XLogP | 1.35 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|