C7H15O12P2S- — CID 59086965
[hydroxy-[2-(4-hydroxy-5-methyl-3-phosphonooxyoxolan-2-yl)ethyl]-oxidophosphaniumyl] sulfate (PubChem CID 59086965) has the molecular formula C7H15O12P2S- and a molecular weight of 385.20 g/mol. Its IUPAC name is [hydroxy-[2-(4-hydroxy-5-methyl-3-phosphonooxyoxolan-2-yl)ethyl]-oxidophosphaniumyl] sulfate.
| Compound Name | [hydroxy-[2-(4-hydroxy-5-methyl-3-phosphonooxyoxolan-2-yl)ethyl]-oxidophosphaniumyl] sulfate |
|---|---|
| PubChem CID | 59086965 |
| Molecular Formula | C7H15O12P2S- |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | [hydroxy-[2-(4-hydroxy-5-methyl-3-phosphonooxyoxolan-2-yl)ethyl]-oxidophosphaniumyl] sulfate |
| SMILES | CC1OC(CC[P+]([O-])(O)OS(=O)(=O)[O-])C(OP(=O)(O)O)C1O |
| InChI | InChI=1S/C7H16O12P2S/c1-4-6(8)7(18-21(11,12)13)5(17-4)2-3-20(9,10)19-22(14,15)16/h4-8H,2-3H2,1H3,(H,9,10)(H2,11,12,13)(H,14,15,16)/p-1 |
| InChIKey | NXNAUGPGNSVPEA-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 205.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|