C34H35FN2O4 — CID 163699543
1-[2-[(5R)-5,6-dihydroxy-3-methylideneoxan-2-yl]ethyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 163699543) has the molecular formula C34H35FN2O4 and a molecular weight of 554.66 g/mol. Its IUPAC name is 1-[2-[(5R)-5,6-dihydroxy-3-methylideneoxan-2-yl]ethyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-[2-[(5R)-5,6-dihydroxy-3-methylideneoxan-2-yl]ethyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 163699543 |
| Molecular Formula | C34H35FN2O4 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 1-[2-[(5R)-5,6-dihydroxy-3-methylideneoxan-2-yl]ethyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=C1C[C@@H](O)C(O)OC1CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C34H35FN2O4/c1-21(2)31-30(33(39)36-26-12-8-5-9-13-26)29(23-10-6-4-7-11-23)32(24-14-16-25(35)17-15-24)37(31)19-18-28-22(3)20-27(38)34(40)41-28/h4-17,21,27-28,34,38,40H,3,18-20H2,1-2H3,(H,36,39)/t27-,28?,34?/m1/s1 |
| InChIKey | JZUSRLXLVLEYEB-QOHVGFNKSA-N |
| XLogP | 6.75 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|