C12H15N — CID 163701489
3-methyl-4-phenyl-1,2,3,4-tetrahydropyridine (PubChem CID 163701489) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-methyl-4-phenyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 163701489 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-methyl-4-phenyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC1CNC=CC1c1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-10-9-13-8-7-12(10)11-5-3-2-4-6-11/h2-8,10,12-13H,9H2,1H3 |
| InChIKey | KBJQNBGVQWWJJE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |