C8H8FIN2 — CID 163707141
(3E,5Z)-5-amino-4-fluoro-6-iodo-2-methylidenehepta-3,5-dienenitrile (PubChem CID 163707141) has the molecular formula C8H8FIN2 and a molecular weight of 278.07 g/mol. Its IUPAC name is (3E,5Z)-5-amino-4-fluoro-6-iodo-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-5-amino-4-fluoro-6-iodo-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 163707141 |
| Molecular Formula | C8H8FIN2 |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | (3E,5Z)-5-amino-4-fluoro-6-iodo-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(F)\C(N)=C(/C)I |
| InChI | InChI=1S/C8H8FIN2/c1-5(4-11)3-7(9)8(12)6(2)10/h3H,1,12H2,2H3/b7-3+,8-6- |
| InChIKey | KGBANMIOBKZYQQ-OLDUDPGPSA-N |
| XLogP | 2.54 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|