C10H14N2 — CID 142300378
(Z,2E)-3-amino-4-methyl-2-prop-2-enylidenehex-3-enenitrile (PubChem CID 142300378) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (Z,2E)-3-amino-4-methyl-2-prop-2-enylidenehex-3-enenitrile.
| Compound Name | (Z,2E)-3-amino-4-methyl-2-prop-2-enylidenehex-3-enenitrile |
|---|---|
| PubChem CID | 142300378 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z,2E)-3-amino-4-methyl-2-prop-2-enylidenehex-3-enenitrile |
| SMILES | C=C/C=C(C#N)\C(N)=C(/C)CC |
| InChI | InChI=1S/C10H14N2/c1-4-6-9(7-11)10(12)8(3)5-2/h4,6H,1,5,12H2,2-3H3/b9-6-,10-8- |
| InChIKey | ILSRHUUBWCBXGF-PTKGMRGESA-N |
| XLogP | 2.27 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|