C10H12N2 — CID 143502790
(3E,5Z)-3-amino-4-ethenyl-2-methylidenehepta-3,5-dienenitrile (PubChem CID 143502790) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (3E,5Z)-3-amino-4-ethenyl-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-3-amino-4-ethenyl-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 143502790 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (3E,5Z)-3-amino-4-ethenyl-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=CC(/C=C\C)=C(\N)C(=C)C#N |
| InChI | InChI=1S/C10H12N2/c1-4-6-9(5-2)10(12)8(3)7-11/h4-6H,2-3,12H2,1H3/b6-4-,10-9+ |
| InChIKey | GILQGFXXAGTFGJ-JWUZIXNGSA-N |
| XLogP | 2.04 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|