C12H17N — CID 163709485
4-cyclohepta-2,4,6-trien-1-ylpiperidine (PubChem CID 163709485) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 4-cyclohepta-2,4,6-trien-1-ylpiperidine.
| Compound Name | 4-cyclohepta-2,4,6-trien-1-ylpiperidine |
|---|---|
| PubChem CID | 163709485 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-cyclohepta-2,4,6-trien-1-ylpiperidine |
| SMILES | C1=CC=CC(C2CCNCC2)C=C1 |
| InChI | InChI=1S/C12H17N/c1-2-4-6-11(5-3-1)12-7-9-13-10-8-12/h1-6,11-13H,7-10H2 |
| InChIKey | KHXYYJFLKNDTTM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |