C17H22INO4 — CID 163710033
4-iodo-2-methyl-6-[[(3,4,5-trimethoxycyclohexa-2,4-dien-1-yl)amino]methylidene]cyclohex-2-en-1-one (PubChem CID 163710033) has the molecular formula C17H22INO4 and a molecular weight of 431.27 g/mol. Its IUPAC name is 4-iodo-2-methyl-6-[[(3,4,5-trimethoxycyclohexa-2,4-dien-1-yl)amino]methylidene]cyclohex-2-en-1-one.
| Compound Name | 4-iodo-2-methyl-6-[[(3,4,5-trimethoxycyclohexa-2,4-dien-1-yl)amino]methylidene]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163710033 |
| Molecular Formula | C17H22INO4 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-iodo-2-methyl-6-[[(3,4,5-trimethoxycyclohexa-2,4-dien-1-yl)amino]methylidene]cyclohex-2-en-1-one |
| SMILES | COC1=CC(NC=C2CC(I)C=C(C)C2=O)CC(OC)=C1OC |
| InChI | InChI=1S/C17H22INO4/c1-10-5-12(18)6-11(16(10)20)9-19-13-7-14(21-2)17(23-4)15(8-13)22-3/h5,7,9,12-13,19H,6,8H2,1-4H3 |
| InChIKey | RMKLPYOFBLCUBR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|