C14H22N2OS — CID 163722190
(2E,3Z)-2-ethylidene-5-[methyl(methylidene)-λ4-sulfanyl]-1-piperazin-1-ylhexa-3,5-dien-1-one (PubChem CID 163722190) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-5-[methyl(methylidene)-λ4-sulfanyl]-1-piperazin-1-ylhexa-3,5-dien-1-one.
| Compound Name | (2E,3Z)-2-ethylidene-5-[methyl(methylidene)-λ4-sulfanyl]-1-piperazin-1-ylhexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 163722190 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2E,3Z)-2-ethylidene-5-[methyl(methylidene)-λ4-sulfanyl]-1-piperazin-1-ylhexa-3,5-dien-1-one |
| SMILES | C=C(/C=C\C(=C/C)C(=O)N1CCNCC1)S(=C)C |
| InChI | InChI=1S/C14H22N2OS/c1-5-13(7-6-12(2)18(3)4)14(17)16-10-8-15-9-11-16/h5-7,15H,2-3,8-11H2,1,4H3/b7-6-,13-5+ |
| InChIKey | KSNRUNFSDYCLLK-ZQNRWWJISA-N |
| XLogP | 1.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|