About 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole
3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole (PubChem CID 163739592) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole.
Analyze 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole?
The IUPAC name of 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole (CID 163739592) is 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole.
What is the SMILES notation for 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole?
The canonical SMILES for 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole is C1CC2=C(C1)ONC2.
What is the InChIKey of 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole?
The InChIKey is LGPNZCGWJSGUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-2-5-4-7-8-6(5)3-1/h7H,1-4H2.
What are the key properties of 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole?
3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole has a molecular weight of 111.14 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetrahydro-2H-cyclopenta[d][1,2]oxazole is sourced from PubChem (CID 163739592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).