C6H10N2 — CID 154262601
1,2,3,4,5,6-hexahydrocyclopenta[c]pyrazole (PubChem CID 154262601) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrazole.
| Compound Name | 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrazole |
|---|---|
| PubChem CID | 154262601 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1,2,3,4,5,6-hexahydrocyclopenta[c]pyrazole |
| SMILES | C1CC2=C(C1)NNC2 |
| InChI | InChI=1S/C6H10N2/c1-2-5-4-7-8-6(5)3-1/h7-8H,1-4H2 |
| InChIKey | LHMLQNAGBIXGMS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |