About 2,3,4,7-tetrahydro-1H-indazole
2,3,4,7-tetrahydro-1H-indazole (PubChem CID 173071838) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-1H-indazole.
Molecular Properties
| Compound Name | 2,3,4,7-tetrahydro-1H-indazole |
| PubChem CID | 173071838 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 2,3,4,7-tetrahydro-1H-indazole |
| SMILES | C1=CCC2=C(C1)CNN2 |
| InChI | InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h1-2,8-9H,3-5H2 |
| InChIKey | OFSCERWONSFDHU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,7-tetrahydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,7-tetrahydro-1H-indazole?
The IUPAC name of 2,3,4,7-tetrahydro-1H-indazole (CID 173071838) is 2,3,4,7-tetrahydro-1H-indazole.
What is the SMILES notation for 2,3,4,7-tetrahydro-1H-indazole?
The canonical SMILES for 2,3,4,7-tetrahydro-1H-indazole is C1=CCC2=C(C1)CNN2.
What is the InChIKey of 2,3,4,7-tetrahydro-1H-indazole?
The InChIKey is OFSCERWONSFDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h1-2,8-9H,3-5H2.
What are the key properties of 2,3,4,7-tetrahydro-1H-indazole?
2,3,4,7-tetrahydro-1H-indazole has a molecular weight of 122.17 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,7-tetrahydro-1H-indazole is sourced from PubChem (CID 173071838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).