C34H43N3O2 — CID 163783950
N-cycloheptyl-4-[(3-methoxyphenyl)-(11-prop-2-enyl-6,11-diazatetracyclo[6.2.1.02,5.02,7]undecan-6-yl)methyl]benzamide (PubChem CID 163783950) has the molecular formula C34H43N3O2 and a molecular weight of 525.74 g/mol. Its IUPAC name is N-cycloheptyl-4-[(3-methoxyphenyl)-(11-prop-2-enyl-6,11-diazatetracyclo[6.2.1.02,5.02,7]undecan-6-yl)methyl]benzamide.
| Compound Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(11-prop-2-enyl-6,11-diazatetracyclo[6.2.1.02,5.02,7]undecan-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 163783950 |
| Molecular Formula | C34H43N3O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(11-prop-2-enyl-6,11-diazatetracyclo[6.2.1.02,5.02,7]undecan-6-yl)methyl]benzamide |
| SMILES | C=CCN1C2CCC1C13CCC1N(C(c1ccc(C(=O)NC4CCCCCC4)cc1)c1cccc(OC)c1)C23 |
| InChI | InChI=1S/C34H43N3O2/c1-3-21-36-28-17-18-29(36)34-20-19-30(34)37(32(28)34)31(25-9-8-12-27(22-25)39-2)23-13-15-24(16-14-23)33(38)35-26-10-6-4-5-7-11-26/h3,8-9,12-16,22,26,28-32H,1,4-7,10-11,17-21H2,2H3,(H,35,38) |
| InChIKey | MQYDVQFBYPPRLA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|