C29H37N3O2 — CID 58313446
[4-[(3-methoxyphenyl)-(9-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-3-yl)methyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 58313446) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is [4-[(3-methoxyphenyl)-(9-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-3-yl)methyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[(3-methoxyphenyl)-(9-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-3-yl)methyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 58313446 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | [4-[(3-methoxyphenyl)-(9-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-3-yl)methyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CCN1C2CCCC1CN(C(c1ccc(C(=O)N3CCCC3)cc1)c1cccc(OC)c1)C2 |
| InChI | InChI=1S/C29H37N3O2/c1-3-16-32-25-9-7-10-26(32)21-31(20-25)28(24-8-6-11-27(19-24)34-2)22-12-14-23(15-13-22)29(33)30-17-4-5-18-30/h3,6,8,11-15,19,25-26,28H,1,4-5,7,9-10,16-18,20-21H2,2H3 |
| InChIKey | UFMHQZDOYQWGHN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|