C31H39N3O2 — CID 53258290
N-cyclopentyl-4-[(3-methoxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]benzamide (PubChem CID 53258290) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-cyclopentyl-4-[(3-methoxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]benzamide.
| Compound Name | N-cyclopentyl-4-[(3-methoxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53258290 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N-cyclopentyl-4-[(3-methoxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]benzamide |
| SMILES | C=CCN1C2CCC1C1CCC2N1C(c1ccc(C(=O)NC2CCCC2)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C31H39N3O2/c1-3-19-33-26-15-16-27(33)29-18-17-28(26)34(29)30(23-7-6-10-25(20-23)36-2)21-11-13-22(14-12-21)31(35)32-24-8-4-5-9-24/h3,6-7,10-14,20,24,26-30H,1,4-5,8-9,15-19H2,2H3,(H,32,35) |
| InChIKey | PEAZDCDRHVUBIN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|