C31H41N3O2 — CID 58313247
N-cycloheptyl-4-[(3-methoxyphenyl)-(8-prop-2-enyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]benzamide (PubChem CID 58313247) has the molecular formula C31H41N3O2 and a molecular weight of 487.69 g/mol. Its IUPAC name is N-cycloheptyl-4-[(3-methoxyphenyl)-(8-prop-2-enyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]benzamide.
| Compound Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(8-prop-2-enyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58313247 |
| Molecular Formula | C31H41N3O2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(8-prop-2-enyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]benzamide |
| SMILES | C=CCN1C2CCC1CN(C(c1ccc(C(=O)NC3CCCCCC3)cc1)c1cccc(OC)c1)C2 |
| InChI | InChI=1S/C31H41N3O2/c1-3-19-34-27-17-18-28(34)22-33(21-27)30(25-9-8-12-29(20-25)36-2)23-13-15-24(16-14-23)31(35)32-26-10-6-4-5-7-11-26/h3,8-9,12-16,20,26-28,30H,1,4-7,10-11,17-19,21-22H2,2H3,(H,32,35) |
| InChIKey | WTWJJSZZAYJSEV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|