C31H43N3O2 — CID 67258614
[4-[9-azabicyclo[4.2.1]nonan-9-yl-(3-methoxyphenyl)methyl]phenyl]-piperidin-1-ylmethanone;prop-2-en-1-amine (PubChem CID 67258614) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is [4-[9-azabicyclo[4.2.1]nonan-9-yl-(3-methoxyphenyl)methyl]phenyl]-piperidin-1-ylmethanone;prop-2-en-1-amine.
| Compound Name | [4-[9-azabicyclo[4.2.1]nonan-9-yl-(3-methoxyphenyl)methyl]phenyl]-piperidin-1-ylmethanone;prop-2-en-1-amine |
|---|---|
| PubChem CID | 67258614 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | [4-[9-azabicyclo[4.2.1]nonan-9-yl-(3-methoxyphenyl)methyl]phenyl]-piperidin-1-ylmethanone;prop-2-en-1-amine |
| SMILES | C=CCN.COc1cccc(C(c2ccc(C(=O)N3CCCCC3)cc2)N2C3CCCCC2CC3)c1 |
| InChI | InChI=1S/C28H36N2O2.C3H7N/c1-32-26-11-7-8-23(20-26)27(30-24-9-3-4-10-25(30)17-16-24)21-12-14-22(15-13-21)28(31)29-18-5-2-6-19-29;1-2-3-4/h7-8,11-15,20,24-25,27H,2-6,9-10,16-19H2,1H3;2H,1,3-4H2 |
| InChIKey | ARAMXOKFOBBCQA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|