C30H39N3O2 — CID 53257406
N-cycloheptyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]benzamide (PubChem CID 53257406) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-cycloheptyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]benzamide.
| Compound Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53257406 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N-cycloheptyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]benzamide |
| SMILES | C=CCN1CC2CC(C1)N2C(c1ccc(C(=O)NC2CCCCCC2)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C30H39N3O2/c1-3-17-32-20-26-19-27(21-32)33(26)29(24-9-8-12-28(18-24)35-2)22-13-15-23(16-14-22)30(34)31-25-10-6-4-5-7-11-25/h3,8-9,12-16,18,25-27,29H,1,4-7,10-11,17,19-21H2,2H3,(H,31,34) |
| InChIKey | XACOXFKVWHOVBU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|