C25H31N3O2 — CID 53257292
4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]-N,N-dimethylbenzamide (PubChem CID 53257292) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 53257292 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]-N,N-dimethylbenzamide |
| SMILES | C=CCN1CC2CC(C1)N2C(c1ccc(C(=O)N(C)C)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-5-13-27-16-21-15-22(17-27)28(21)24(20-7-6-8-23(14-20)30-4)18-9-11-19(12-10-18)25(29)26(2)3/h5-12,14,21-22,24H,1,13,15-17H2,2-4H3 |
| InChIKey | LLUMCRDEZIDRQP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|