C14H24N2 — CID 163795963
1-methyl-1-(3,3,6,6,8-pentamethylcycloocta-1,4,7-trien-1-yl)hydrazine (PubChem CID 163795963) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methyl-1-(3,3,6,6,8-pentamethylcycloocta-1,4,7-trien-1-yl)hydrazine.
| Compound Name | 1-methyl-1-(3,3,6,6,8-pentamethylcycloocta-1,4,7-trien-1-yl)hydrazine |
|---|---|
| PubChem CID | 163795963 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-methyl-1-(3,3,6,6,8-pentamethylcycloocta-1,4,7-trien-1-yl)hydrazine |
| SMILES | CC1=CC(C)(C)C=CC(C)(C)C=C1N(C)N |
| InChI | InChI=1S/C14H24N2/c1-11-9-13(2,3)7-8-14(4,5)10-12(11)16(6)15/h7-10H,15H2,1-6H3 |
| InChIKey | NAUNNLDGCQQKLL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|