C18H23IN6 — CID 163807506
2-iodo-7-[2-(5,6,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 163807506) has the molecular formula C18H23IN6 and a molecular weight of 450.33 g/mol. Its IUPAC name is 2-iodo-7-[2-(5,6,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 2-iodo-7-[2-(5,6,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 163807506 |
| Molecular Formula | C18H23IN6 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-iodo-7-[2-(5,6,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CC1=NC(C)C(C)n2nc(CCc3ccc4c(n3)NC(I)CC4)nc21 |
| InChI | InChI=1S/C18H23IN6/c1-10-12(3)25-18(11(2)20-10)23-16(24-25)9-7-14-6-4-13-5-8-15(19)22-17(13)21-14/h4,6,10,12,15H,5,7-9H2,1-3H3,(H,21,22) |
| InChIKey | NKHLJLDBLQEGGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|