C30H39N3 — CID 123729146
3,4,8,9-tetramethyl-2-[2-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-4,4a,5,8,9,10-hexahydroheptaleno[1,2-b]pyridine (PubChem CID 123729146) has the molecular formula C30H39N3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 3,4,8,9-tetramethyl-2-[2-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-4,4a,5,8,9,10-hexahydroheptaleno[1,2-b]pyridine.
| Compound Name | 3,4,8,9-tetramethyl-2-[2-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-4,4a,5,8,9,10-hexahydroheptaleno[1,2-b]pyridine |
|---|---|
| PubChem CID | 123729146 |
| Molecular Formula | C30H39N3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 3,4,8,9-tetramethyl-2-[2-(7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-4,4a,5,8,9,10-hexahydroheptaleno[1,2-b]pyridine |
| SMILES | CC1=C(CCc2ccc3c(n2)NC(C)CC3)N=C2C3=C(C=CCC2C1C)C(C)C(C)CC=C3 |
| InChI | InChI=1S/C30H39N3/c1-18-8-6-11-27-25(20(18)3)9-7-10-26-21(4)22(5)28(33-29(26)27)17-16-24-15-14-23-13-12-19(2)31-30(23)32-24/h6-7,9,11,14-15,18-21,26H,8,10,12-13,16-17H2,1-5H3,(H,31,32) |
| InChIKey | PSHKZILUXSKLBM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |