C21H34S — CID 163810201
1-[2-[2-[[(E)-2-methylhex-2-enyl]sulfanylmethyl]butyl]cyclobutyl]cyclopenta-1,2-diene (PubChem CID 163810201) has the molecular formula C21H34S and a molecular weight of 318.57 g/mol. Its IUPAC name is 1-[2-[2-[[(E)-2-methylhex-2-enyl]sulfanylmethyl]butyl]cyclobutyl]cyclopenta-1,2-diene.
| Compound Name | 1-[2-[2-[[(E)-2-methylhex-2-enyl]sulfanylmethyl]butyl]cyclobutyl]cyclopenta-1,2-diene |
|---|---|
| PubChem CID | 163810201 |
| Molecular Formula | C21H34S |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 1-[2-[2-[[(E)-2-methylhex-2-enyl]sulfanylmethyl]butyl]cyclobutyl]cyclopenta-1,2-diene |
| SMILES | CCC/C=C(\C)CSCC(CC)CC1CCC1C1=C=CCC1 |
| InChI | InChI=1S/C21H34S/c1-4-6-9-17(3)15-22-16-18(5-2)14-20-12-13-21(20)19-10-7-8-11-19/h7,9,18,20-21H,4-6,8,11-16H2,1-3H3/b17-9+ |
| InChIKey | NMOWZTVRTIEJJS-RQZCQDPDSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|