C13H23N3 — CID 163826978
2,3-dimethyl-1,2,3,4,4a,5,5a,6,7,8,10,10a-dodecahydropyrido[2,3-b][1,8]naphthyridine (PubChem CID 163826978) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2,3-dimethyl-1,2,3,4,4a,5,5a,6,7,8,10,10a-dodecahydropyrido[2,3-b][1,8]naphthyridine.
| Compound Name | 2,3-dimethyl-1,2,3,4,4a,5,5a,6,7,8,10,10a-dodecahydropyrido[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 163826978 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2,3-dimethyl-1,2,3,4,4a,5,5a,6,7,8,10,10a-dodecahydropyrido[2,3-b][1,8]naphthyridine |
| SMILES | CC1CC2CC3CCCN=C3NC2NC1C |
| InChI | InChI=1S/C13H23N3/c1-8-6-11-7-10-4-3-5-14-12(10)16-13(11)15-9(8)2/h8-11,13,15H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | OAHZVFAGGQOYRL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |