C22H41N3 — CID 71596060
(3R,5S,9R,11S)-3,11-bis(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596060) has the molecular formula C22H41N3 and a molecular weight of 347.59 g/mol. Its IUPAC name is (3R,5S,9R,11S)-3,11-bis(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3R,5S,9R,11S)-3,11-bis(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596060 |
| Molecular Formula | C22H41N3 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.33 |
| IUPAC Name | (3R,5S,9R,11S)-3,11-bis(4-methylpentyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CC(C)CCC[C@@H]1C[C@@H]2CCC[C@@H]3C[C@H](CCCC(C)C)NC(=N1)N32 |
| InChI | InChI=1S/C22H41N3/c1-16(2)8-5-10-18-14-20-12-7-13-21-15-19(11-6-9-17(3)4)24-22(23-18)25(20)21/h16-21H,5-15H2,1-4H3,(H,23,24)/t18-,19+,20+,21- |
| InChIKey | HVIAFRRTEATEGQ-UJOPUZHASA-N |
| XLogP | 5.35 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |