C25H51N7 — CID 122500959
1-butyl-2-methyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]guanidine (PubChem CID 122500959) has the molecular formula C25H51N7 and a molecular weight of 449.73 g/mol. Its IUPAC name is 1-butyl-2-methyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]guanidine.
| Compound Name | 1-butyl-2-methyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]guanidine |
|---|---|
| PubChem CID | 122500959 |
| Molecular Formula | C25H51N7 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.42 |
| IUPAC Name | 1-butyl-2-methyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]guanidine |
| SMILES | CCCCN(/C(=N/C)N/C(N)=N/C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H51N7/c1-11-12-13-32(19-16-24(6,7)31-25(8,9)17-19)21(27-10)29-20(26)28-18-14-22(2,3)30-23(4,5)15-18/h18-19,30-31H,11-17H2,1-10H3,(H3,26,27,28,29) |
| InChIKey | WUKHVTSQTYDPNV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|