C17H31N5 — CID 19741925
2-cyano-1-cyclohexyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine (PubChem CID 19741925) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-cyano-1-cyclohexyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine.
| Compound Name | 2-cyano-1-cyclohexyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 19741925 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 2-cyano-1-cyclohexyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
| SMILES | CC1(C)CC(N(/C(N)=N/C#N)C2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H31N5/c1-16(2)10-14(11-17(3,4)21-16)22(15(19)20-12-18)13-8-6-5-7-9-13/h13-14,21H,5-11H2,1-4H3,(H2,19,20) |
| InChIKey | GZMZVFNKXAWXQG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|