C19H37N5 — CID 57284883
1-cyano-2-octyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine (PubChem CID 57284883) has the molecular formula C19H37N5 and a molecular weight of 335.54 g/mol. Its IUPAC name is 1-cyano-2-octyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine.
| Compound Name | 1-cyano-2-octyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 57284883 |
| Molecular Formula | C19H37N5 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 1-cyano-2-octyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
| SMILES | CCCCCCCC/N=C(\N)N(C#N)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H37N5/c1-6-7-8-9-10-11-12-22-17(21)24(15-20)16-13-18(2,3)23-19(4,5)14-16/h16,23H,6-14H2,1-5H3,(H2,21,22) |
| InChIKey | VBSHBOAGGMXFRP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|