C13H24N6 — CID 547468
6-amino-3-(2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydro-1,3,5-triazine-1-carbonitrile (PubChem CID 547468) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 6-amino-3-(2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydro-1,3,5-triazine-1-carbonitrile.
| Compound Name | 6-amino-3-(2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydro-1,3,5-triazine-1-carbonitrile |
|---|---|
| PubChem CID | 547468 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-amino-3-(2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydro-1,3,5-triazine-1-carbonitrile |
| SMILES | CC1(C)CC(N2CN=C(N)N(C#N)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C13H24N6/c1-12(2)5-10(6-13(3,4)17-12)19-8-16-11(15)18(7-14)9-19/h10,17H,5-6,8-9H2,1-4H3,(H2,15,16) |
| InChIKey | IBFSDNKARCJMQF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|