C20H41N3 — CID 166942214
6-tert-butyl-1-nonan-5-yl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidine (PubChem CID 166942214) has the molecular formula C20H41N3 and a molecular weight of 323.57 g/mol. Its IUPAC name is 6-tert-butyl-1-nonan-5-yl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidine.
| Compound Name | 6-tert-butyl-1-nonan-5-yl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 166942214 |
| Molecular Formula | C20H41N3 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.33 |
| IUPAC Name | 6-tert-butyl-1-nonan-5-yl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidine |
| SMILES | CCCCC(CCCC)N1CNCC2CN(C(C)(C)C)CCC21 |
| InChI | InChI=1S/C20H41N3/c1-6-8-10-18(11-9-7-2)23-16-21-14-17-15-22(20(3,4)5)13-12-19(17)23/h17-19,21H,6-16H2,1-5H3 |
| InChIKey | FAYLJQQGVZFEOL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |