C25H49N7 — CID 163704433
4-N,6-N,1,2-tetramethyl-4-N,6-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine-4,6-diamine (PubChem CID 163704433) has the molecular formula C25H49N7 and a molecular weight of 447.72 g/mol. Its IUPAC name is 4-N,6-N,1,2-tetramethyl-4-N,6-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 4-N,6-N,1,2-tetramethyl-4-N,6-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 163704433 |
| Molecular Formula | C25H49N7 |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 447.40 |
| IUPAC Name | 4-N,6-N,1,2-tetramethyl-4-N,6-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2H-1,3,5-triazine-4,6-diamine |
| SMILES | CC1N=C(N(C)C2CC(C)(C)NC(C)(C)C2)N=C(N(C)C2CC(C)(C)NC(C)(C)C2)N1C |
| InChI | InChI=1S/C25H49N7/c1-17-26-20(31(11)18-13-22(2,3)28-23(4,5)14-18)27-21(30(17)10)32(12)19-15-24(6,7)29-25(8,9)16-19/h17-19,28-29H,13-16H2,1-12H3 |
| InChIKey | KDUUKIGBEBSXFH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |