C20H37N3 — CID 71596330
(3R,5S,9R,11S)-3,11-dipentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596330) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is (3R,5S,9R,11S)-3,11-dipentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3R,5S,9R,11S)-3,11-dipentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596330 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | (3R,5S,9R,11S)-3,11-dipentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CCCCC[C@@H]1C[C@@H]2CCC[C@@H]3C[C@H](CCCCC)NC(=N1)N32 |
| InChI | InChI=1S/C20H37N3/c1-3-5-7-10-16-14-18-12-9-13-19-15-17(11-8-6-4-2)22-20(21-16)23(18)19/h16-19H,3-15H2,1-2H3,(H,21,22)/t16-,17+,18+,19- |
| InChIKey | YZUXNVBUYRUXFD-SEXKYXSUSA-N |
| XLogP | 4.86 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|