C16H29N3 — CID 71596425
11-methyl-3-pentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596425) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 11-methyl-3-pentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | 11-methyl-3-pentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596425 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 11-methyl-3-pentyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CCCCCC1CC2CCCC3CC(C)NC(=N1)N23 |
| InChI | InChI=1S/C16H29N3/c1-3-4-5-7-13-11-15-9-6-8-14-10-12(2)17-16(18-13)19(14)15/h12-15H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | HTHDKFGMVZHIEG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|