C12H18N2 — CID 163827048
7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,11-diene (PubChem CID 163827048) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,11-diene.
| Compound Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,11-diene |
|---|---|
| PubChem CID | 163827048 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,11-diene |
| SMILES | C1=CN2CCN3CCC=CC3C2CC1 |
| InChI | InChI=1S/C12H18N2/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1/h1,4-5,8,11-12H,2-3,6-7,9-10H2 |
| InChIKey | OAJHNYQZLYEJQY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|