C14H11N3O4 — CID 163837901
5-[(4-aminophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 163837901) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-[(4-aminophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-[(4-aminophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 163837901 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-[(4-aminophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Nc1ccc(Cc2cc(=O)oc3[nH]c(=O)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C14H11N3O4/c15-9-3-1-7(2-4-9)5-8-6-10(18)21-13-11(8)12(19)16-14(20)17-13/h1-4,6H,5,15H2,(H2,16,17,19,20) |
| InChIKey | OJKAZJCMTZGCJZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 121.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|