C20H17N3O4 — CID 59304785
5-(2-cyclobutylethyl)-6-(4-isocyanophenyl)-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304785) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-(2-cyclobutylethyl)-6-(4-isocyanophenyl)-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(2-cyclobutylethyl)-6-(4-isocyanophenyl)-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304785 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-(2-cyclobutylethyl)-6-(4-isocyanophenyl)-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | [C-]#[N+]c1ccc(-c2c(CCC3CCC3)c3c(=O)[nH]c(=O)[nH]c3oc2=O)cc1 |
| InChI | InChI=1S/C20H17N3O4/c1-21-13-8-6-12(7-9-13)15-14(10-5-11-3-2-4-11)16-17(24)22-20(26)23-18(16)27-19(15)25/h6-9,11H,2-5,10H2,(H2,22,23,24,26) |
| InChIKey | PPMQZQBLJUDKJP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|